2-amino-N-propan-2-ylbenzamide
Catalog No: FT-0709331
CAS No: 30391-89-0
- Chemical Name: 2-amino-N-propan-2-ylbenzamide
- Molecular Formula: C10H14N2O
- Molecular Weight: 178.23
- InChI Key: FWQYJOPJMIEKHZ-UHFFFAOYSA-N
- InChI: InChI=1S/C10H14N2O/c1-7(2)12-10(13)8-5-3-4-6-9(8)11/h3-7H,11H2,1-2H3,(H,12,13)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS07 |
|---|---|
| CAS: | 30391-89-0 |
| Flash_Point: | 168.9ºC |
| Product_Name: | 2-amino-N-propan-2-ylbenzamide |
| Bolling_Point: | 355.7ºC at 760mmHg |
| FW: | 178.23100 |
| Melting_Point: | N/A |
| MF: | C10H14N2O |
| Density: | 1.077g/cm3 |
| FW: | 178.23100 |
|---|---|
| Refractive_Index: | 1.557 |
| MF: | C10H14N2O |
| Exact_Mass: | 178.11100 |
| LogP: | 2.37910 |
| Bolling_Point: | 355.7ºC at 760mmHg |
| Density: | 1.077g/cm3 |
| PSA: | 55.12000 |
| Flash_Point: | 168.9ºC |
| Symbol: | GHS07 |
|---|---|
| Risk_Statements(EU): | 22-36/37/38 |
| Personal_Protective_Equipment: | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2924299090 |
| Hazard_Codes: | Xi: Irritant;Xn: Harmful; |
| Warning_Statement: | P261-P305 + P351 + P338 |
| Safety_Statements: | H302-H315-H319-H335 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)